C12H24N2O2S — CID 71980784
1-[2-(hydroxymethyl)cyclohexyl]-3-(1-methylsulfanylpropan-2-yl)urea (PubChem CID 71980784) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)cyclohexyl]-3-(1-methylsulfanylpropan-2-yl)urea.
| Compound Name | 1-[2-(hydroxymethyl)cyclohexyl]-3-(1-methylsulfanylpropan-2-yl)urea |
|---|---|
| PubChem CID | 71980784 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-[2-(hydroxymethyl)cyclohexyl]-3-(1-methylsulfanylpropan-2-yl)urea |
| SMILES | CSCC(C)NC(=O)NC1CCCCC1CO |
| InChI | InChI=1S/C12H24N2O2S/c1-9(8-17-2)13-12(16)14-11-6-4-3-5-10(11)7-15/h9-11,15H,3-8H2,1-2H3,(H2,13,14,16) |
| InChIKey | ZESVIPQKNZTVJJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |