C11H13ClFNOS — CID 71981064
2-[2-(2-chloro-6-fluorophenyl)ethylsulfanyl]propanamide (PubChem CID 71981064) has the molecular formula C11H13ClFNOS and a molecular weight of 261.75 g/mol. Its IUPAC name is 2-[2-(2-chloro-6-fluorophenyl)ethylsulfanyl]propanamide.
| Compound Name | 2-[2-(2-chloro-6-fluorophenyl)ethylsulfanyl]propanamide |
|---|---|
| PubChem CID | 71981064 |
| Molecular Formula | C11H13ClFNOS |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-[2-(2-chloro-6-fluorophenyl)ethylsulfanyl]propanamide |
| SMILES | CC(SCCc1c(F)cccc1Cl)C(N)=O |
| InChI | InChI=1S/C11H13ClFNOS/c1-7(11(14)15)16-6-5-8-9(12)3-2-4-10(8)13/h2-4,7H,5-6H2,1H3,(H2,14,15) |
| InChIKey | XMGULJHGACHFQX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |