C15H15ClFN3O2 — CID 71981389
N-(5-chloro-2-methoxyphenyl)-3-[(6-fluoro-2-pyridinyl)amino]propanamide (PubChem CID 71981389) has the molecular formula C15H15ClFN3O2 and a molecular weight of 323.75 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-3-[(6-fluoro-2-pyridinyl)amino]propanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-3-[(6-fluoro-2-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 71981389 |
| Molecular Formula | C15H15ClFN3O2 |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-3-[(6-fluoro-2-pyridinyl)amino]propanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CCNc1cccc(F)n1 |
| InChI | InChI=1S/C15H15ClFN3O2/c1-22-12-6-5-10(16)9-11(12)19-15(21)7-8-18-14-4-2-3-13(17)20-14/h2-6,9H,7-8H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | CRYFFWOJKYBUIJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|