About 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea (PubChem CID 71981534) has the molecular formula C16H23N5O2S
and a molecular weight of 349.46 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea.
Molecular Properties
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
| PubChem CID | 71981534 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
| SMILES | CCc1cnc(CN(C)C(=O)Nc2cnn(CC3CCCO3)c2)s1 |
| InChI | InChI=1S/C16H23N5O2S/c1-3-14-8-17-15(24-14)11-20(2)16(22)19-12-7-18-21(9-12)10-13-5-4-6-23-13/h7-9,13H,3-6,10-11H2,1-2H3,(H,19,22) |
| InChIKey | QKQNTMFTCNVODL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea?
The IUPAC name of 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea (CID 71981534) is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea.
What is the SMILES notation for 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea?
The canonical SMILES for 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea is CCc1cnc(CN(C)C(=O)Nc2cnn(CC3CCCO3)c2)s1.
What is the InChIKey of 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea?
The InChIKey is QKQNTMFTCNVODL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O2S/c1-3-14-8-17-15(24-14)11-20(2)16(22)19-12-7-18-21(9-12)10-13-5-4-6-23-13/h7-9,13H,3-6,10-11H2,1-2H3,(H,19,22).
What are the key properties of 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea?
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea has a molecular weight of 349.46 g/mol, XLogP of 2.74, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea is sourced from PubChem (CID 71981534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).