C13H18F3N3OS — CID 71981581
2-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 71981581) has the molecular formula C13H18F3N3OS and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 71981581 |
| Molecular Formula | C13H18F3N3OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-[methyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CN(CC(=O)NCC(F)(F)F)Cc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C13H18F3N3OS/c1-19(6-11(20)17-8-13(14,15)16)7-12-18-9-4-2-3-5-10(9)21-12/h2-8H2,1H3,(H,17,20) |
| InChIKey | XOVRPEDNYOEXJI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |