C10H17N3OS — CID 71981834
3-ethyl-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methylurea (PubChem CID 71981834) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-ethyl-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methylurea.
| Compound Name | 3-ethyl-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 71981834 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-ethyl-1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-methylurea |
| SMILES | CCNC(=O)N(C)Cc1ncc(CC)s1 |
| InChI | InChI=1S/C10H17N3OS/c1-4-8-6-12-9(15-8)7-13(3)10(14)11-5-2/h6H,4-5,7H2,1-3H3,(H,11,14) |
| InChIKey | BEHKCJPGVNJECH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |