About 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate
2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 71982424) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate |
| PubChem CID | 71982424 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | Cc1ccc(C(=O)OCCN(C)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H18N2O3/c1-12-8-9-14(15(19)17-12)16(20)21-11-10-18(2)13-6-4-3-5-7-13/h3-9H,10-11H2,1-2H3,(H,17,19) |
| InChIKey | ASXGBJSVCADYCD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate?
The IUPAC name of 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate (CID 71982424) is 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate.
What is the SMILES notation for 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate?
The canonical SMILES for 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate is Cc1ccc(C(=O)OCCN(C)c2ccccc2)c(=O)[nH]1.
What is the InChIKey of 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate?
The InChIKey is ASXGBJSVCADYCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-12-8-9-14(15(19)17-12)16(20)21-11-10-18(2)13-6-4-3-5-7-13/h3-9H,10-11H2,1-2H3,(H,17,19).
What are the key properties of 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate?
2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate has a molecular weight of 286.33 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-methylanilino)ethyl 6-methyl-2-oxo-1H-pyridine-3-carboxylate is sourced from PubChem (CID 71982424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).