About 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate
1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate (PubChem CID 71982462) has the molecular formula C13H13NO3S
and a molecular weight of 263.32 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate.
Molecular Properties
| Compound Name | 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate |
| PubChem CID | 71982462 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OC(C)c1nccs1 |
| InChI | InChI=1S/C13H13NO3S/c1-9(12-14-7-8-18-12)17-13(15)10-5-3-4-6-11(10)16-2/h3-9H,1-2H3 |
| InChIKey | SVFDTYNQLQKHEB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate?
The IUPAC name of 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate (CID 71982462) is 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate.
What is the SMILES notation for 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate?
The canonical SMILES for 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate is COc1ccccc1C(=O)OC(C)c1nccs1.
What is the InChIKey of 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate?
The InChIKey is SVFDTYNQLQKHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-9(12-14-7-8-18-12)17-13(15)10-5-3-4-6-11(10)16-2/h3-9H,1-2H3.
What are the key properties of 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate?
1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate has a molecular weight of 263.32 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazol-2-yl)ethyl 2-methoxybenzoate is sourced from PubChem (CID 71982462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).