About (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone
(1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone (PubChem CID 71982505) has the molecular formula C11H17N3O3S
and a molecular weight of 271.34 g/mol. Its IUPAC name is (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone.
Molecular Properties
| Compound Name | (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone |
| PubChem CID | 71982505 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2CCCS2(=O)=O)n(C)n1 |
| InChI | InChI=1S/C11H17N3O3S/c1-8(2)9-7-10(13(3)12-9)11(15)14-5-4-6-18(14,16)17/h7-8H,4-6H2,1-3H3 |
| InChIKey | WNPUBQNVUKRFEN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone?
The IUPAC name of (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone (CID 71982505) is (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone.
What is the SMILES notation for (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone?
The canonical SMILES for (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone is CC(C)c1cc(C(=O)N2CCCS2(=O)=O)n(C)n1.
What is the InChIKey of (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone?
The InChIKey is WNPUBQNVUKRFEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3S/c1-8(2)9-7-10(13(3)12-9)11(15)14-5-4-6-18(14,16)17/h7-8H,4-6H2,1-3H3.
What are the key properties of (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone?
(1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone has a molecular weight of 271.34 g/mol, XLogP of 0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dioxo-1,2-thiazolidin-2-yl)-(1-methyl-3-propan-2-ylpyrazol-5-yl)methanone is sourced from PubChem (CID 71982505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).