About 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide
2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide (PubChem CID 71982863) has the molecular formula C18H24N4O3
and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide |
| PubChem CID | 71982863 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)NCc2ncc(C(C)(C)C)o2)cc1 |
| InChI | InChI=1S/C18H24N4O3/c1-18(2,3)14-10-20-16(25-14)11-21-17(24)22-13-7-5-12(6-8-13)9-15(23)19-4/h5-8,10H,9,11H2,1-4H3,(H,19,23)(H2,21,22,24) |
| InChIKey | TXJNFXSHNVIHAB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide?
The IUPAC name of 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide (CID 71982863) is 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide.
What is the SMILES notation for 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide?
The canonical SMILES for 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide is CNC(=O)Cc1ccc(NC(=O)NCc2ncc(C(C)(C)C)o2)cc1.
What is the InChIKey of 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide?
The InChIKey is TXJNFXSHNVIHAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O3/c1-18(2,3)14-10-20-16(25-14)11-21-17(24)22-13-7-5-12(6-8-13)9-15(23)19-4/h5-8,10H,9,11H2,1-4H3,(H,19,23)(H2,21,22,24).
What are the key properties of 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide?
2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide has a molecular weight of 344.42 g/mol, XLogP of 2.58, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(5-tert-butyl-1,3-oxazol-2-yl)methylcarbamoylamino]phenyl]-N-methylacetamide is sourced from PubChem (CID 71982863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).