About 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile
6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile (PubChem CID 71983549) has the molecular formula C13H16N6
and a molecular weight of 256.31 g/mol. Its IUPAC name is 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile |
| PubChem CID | 71983549 |
| Molecular Formula | C13H16N6 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile |
| SMILES | CC(C)c1nncn1CCNc1ccc(C#N)cn1 |
| InChI | InChI=1S/C13H16N6/c1-10(2)13-18-17-9-19(13)6-5-15-12-4-3-11(7-14)8-16-12/h3-4,8-10H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | BTNFGFSEKHDWSJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile?
The IUPAC name of 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile (CID 71983549) is 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile.
What is the SMILES notation for 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile?
The canonical SMILES for 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile is CC(C)c1nncn1CCNc1ccc(C#N)cn1.
What is the InChIKey of 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile?
The InChIKey is BTNFGFSEKHDWSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N6/c1-10(2)13-18-17-9-19(13)6-5-15-12-4-3-11(7-14)8-16-12/h3-4,8-10H,5-6H2,1-2H3,(H,15,16).
What are the key properties of 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile?
6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile has a molecular weight of 256.31 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethylamino]pyridine-3-carbonitrile is sourced from PubChem (CID 71983549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).