C12H15N2O3+ — CID 7198359
[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 7198359) has the molecular formula C12H15N2O3+ and a molecular weight of 235.26 g/mol. Its IUPAC name is [(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | [(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7198359 |
| Molecular Formula | C12H15N2O3+ |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | [(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | CCOc1ccc(N2C(=O)C[C@@H]([NH3+])C2=O)cc1 |
| InChI | InChI=1S/C12H14N2O3/c1-2-17-9-5-3-8(4-6-9)14-11(15)7-10(13)12(14)16/h3-6,10H,2,7,13H2,1H3/p+1/t10-/m1/s1 |
| InChIKey | WGEGMIILLWSJIS-SNVBAGLBSA-O |
| XLogP | -0.04 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|