About N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide
N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide (PubChem CID 71983876) has the molecular formula C16H28N2O3
and a molecular weight of 296.41 g/mol. Its IUPAC name is N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide.
Molecular Properties
| Compound Name | N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide |
| PubChem CID | 71983876 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide |
| SMILES | CCC(C(=O)NC1CC(C)(OC)C1(C)C)N1CCCC1=O |
| InChI | InChI=1S/C16H28N2O3/c1-6-11(18-9-7-8-13(18)19)14(20)17-12-10-16(4,21-5)15(12,2)3/h11-12H,6-10H2,1-5H3,(H,17,20) |
| InChIKey | JYHIMCTXOQUTEI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide?
The IUPAC name of N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide (CID 71983876) is N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide.
What is the SMILES notation for N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide?
The canonical SMILES for N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide is CCC(C(=O)NC1CC(C)(OC)C1(C)C)N1CCCC1=O.
What is the InChIKey of N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide?
The InChIKey is JYHIMCTXOQUTEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O3/c1-6-11(18-9-7-8-13(18)19)14(20)17-12-10-16(4,21-5)15(12,2)3/h11-12H,6-10H2,1-5H3,(H,17,20).
What are the key properties of N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide?
N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide has a molecular weight of 296.41 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxy-2,2,3-trimethylcyclobutyl)-2-(2-oxopyrrolidin-1-yl)butanamide is sourced from PubChem (CID 71983876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).