C15H23F3N2O2 — CID 71983929
4,4-dimethyl-N-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]pent-2-enamide (PubChem CID 71983929) has the molecular formula C15H23F3N2O2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 4,4-dimethyl-N-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]pent-2-enamide.
| Compound Name | 4,4-dimethyl-N-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]pent-2-enamide |
|---|---|
| PubChem CID | 71983929 |
| Molecular Formula | C15H23F3N2O2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4,4-dimethyl-N-[[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]methyl]pent-2-enamide |
| SMILES | CC(C)(C)C=CC(=O)NCC1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H23F3N2O2/c1-14(2,3)7-4-12(21)19-10-11-5-8-20(9-6-11)13(22)15(16,17)18/h4,7,11H,5-6,8-10H2,1-3H3,(H,19,21) |
| InChIKey | KQUBDQXZRXMXDS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|