C16H21FN4OS — CID 71983996
N-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-2-(4-fluorophenyl)-2-methylpropanamide (PubChem CID 71983996) has the molecular formula C16H21FN4OS and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-2-(4-fluorophenyl)-2-methylpropanamide.
| Compound Name | N-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-2-(4-fluorophenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 71983996 |
| Molecular Formula | C16H21FN4OS |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-[2-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-2-(4-fluorophenyl)-2-methylpropanamide |
| SMILES | CCc1n[nH]c(=S)n1CCNC(=O)C(C)(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN4OS/c1-4-13-19-20-15(23)21(13)10-9-18-14(22)16(2,3)11-5-7-12(17)8-6-11/h5-8H,4,9-10H2,1-3H3,(H,18,22)(H,20,23) |
| InChIKey | UQLYMRILGVKVOI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|