C19H16N4O3 — CID 71984467
3-(1,2,4-oxadiazol-3-yl)-N-(5-oxo-1-phenylpyrrolidin-3-yl)benzamide (PubChem CID 71984467) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-(1,2,4-oxadiazol-3-yl)-N-(5-oxo-1-phenylpyrrolidin-3-yl)benzamide.
| Compound Name | 3-(1,2,4-oxadiazol-3-yl)-N-(5-oxo-1-phenylpyrrolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 71984467 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3-(1,2,4-oxadiazol-3-yl)-N-(5-oxo-1-phenylpyrrolidin-3-yl)benzamide |
| SMILES | O=C(NC1CC(=O)N(c2ccccc2)C1)c1cccc(-c2ncon2)c1 |
| InChI | InChI=1S/C19H16N4O3/c24-17-10-15(11-23(17)16-7-2-1-3-8-16)21-19(25)14-6-4-5-13(9-14)18-20-12-26-22-18/h1-9,12,15H,10-11H2,(H,21,25) |
| InChIKey | XVTKBDATVWJZHY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |