C12H16N6O — CID 71984790
1,1-diethyl-3-(1-pyrimidin-2-ylpyrazol-4-yl)urea (PubChem CID 71984790) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 1,1-diethyl-3-(1-pyrimidin-2-ylpyrazol-4-yl)urea.
| Compound Name | 1,1-diethyl-3-(1-pyrimidin-2-ylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 71984790 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1,1-diethyl-3-(1-pyrimidin-2-ylpyrazol-4-yl)urea |
| SMILES | CCN(CC)C(=O)Nc1cnn(-c2ncccn2)c1 |
| InChI | InChI=1S/C12H16N6O/c1-3-17(4-2)12(19)16-10-8-15-18(9-10)11-13-6-5-7-14-11/h5-9H,3-4H2,1-2H3,(H,16,19) |
| InChIKey | FBCPCJQYZJQRMW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |