About 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea
1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea (PubChem CID 71984817) has the molecular formula C15H21N5O2S
and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea.
Molecular Properties
| Compound Name | 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
| PubChem CID | 71984817 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
| SMILES | Cc1csc(CN(C)C(=O)Nc2cnn(CC3CCCO3)c2)n1 |
| InChI | InChI=1S/C15H21N5O2S/c1-11-10-23-14(17-11)9-19(2)15(21)18-12-6-16-20(7-12)8-13-4-3-5-22-13/h6-7,10,13H,3-5,8-9H2,1-2H3,(H,18,21) |
| InChIKey | LXBWWGZEIAIHTI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea?
The IUPAC name of 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea (CID 71984817) is 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea.
What is the SMILES notation for 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea?
The canonical SMILES for 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea is Cc1csc(CN(C)C(=O)Nc2cnn(CC3CCCO3)c2)n1.
What is the InChIKey of 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea?
The InChIKey is LXBWWGZEIAIHTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5O2S/c1-11-10-23-14(17-11)9-19(2)15(21)18-12-6-16-20(7-12)8-13-4-3-5-22-13/h6-7,10,13H,3-5,8-9H2,1-2H3,(H,18,21).
What are the key properties of 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea?
1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea has a molecular weight of 335.43 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea is sourced from PubChem (CID 71984817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).