C15H17ClF2N2O3 — CID 71985788
N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-(2-oxopiperidin-1-yl)acetamide (PubChem CID 71985788) has the molecular formula C15H17ClF2N2O3 and a molecular weight of 346.76 g/mol. Its IUPAC name is N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-(2-oxopiperidin-1-yl)acetamide.
| Compound Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-(2-oxopiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 71985788 |
| Molecular Formula | C15H17ClF2N2O3 |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-(2-oxopiperidin-1-yl)acetamide |
| SMILES | O=C(CN1CCCCC1=O)NCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C15H17ClF2N2O3/c16-11-4-5-12(23-15(17)18)10(7-11)8-19-13(21)9-20-6-2-1-3-14(20)22/h4-5,7,15H,1-3,6,8-9H2,(H,19,21) |
| InChIKey | JFPAWFLMDITKMQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |