C15H28N2O3 — CID 71985966
N-ethyl-N'-(3-methoxy-2,2,3-trimethylcyclobutyl)pentanediamide (PubChem CID 71985966) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is N-ethyl-N'-(3-methoxy-2,2,3-trimethylcyclobutyl)pentanediamide.
| Compound Name | N-ethyl-N'-(3-methoxy-2,2,3-trimethylcyclobutyl)pentanediamide |
|---|---|
| PubChem CID | 71985966 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | N-ethyl-N'-(3-methoxy-2,2,3-trimethylcyclobutyl)pentanediamide |
| SMILES | CCNC(=O)CCCC(=O)NC1CC(C)(OC)C1(C)C |
| InChI | InChI=1S/C15H28N2O3/c1-6-16-12(18)8-7-9-13(19)17-11-10-15(4,20-5)14(11,2)3/h11H,6-10H2,1-5H3,(H,16,18)(H,17,19) |
| InChIKey | YFDAYFFEAXWRJK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |