About N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide
N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide (PubChem CID 71986830) has the molecular formula C10H19N3O2S2
and a molecular weight of 277.41 g/mol. Its IUPAC name is N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide |
| PubChem CID | 71986830 |
| Molecular Formula | C10H19N3O2S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide |
| SMILES | CNS(=O)(=O)CCCNC(C)(C)c1nccs1 |
| InChI | InChI=1S/C10H19N3O2S2/c1-10(2,9-12-6-7-16-9)13-5-4-8-17(14,15)11-3/h6-7,11,13H,4-5,8H2,1-3H3 |
| InChIKey | MROAWYLIIQPHBX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide?
The IUPAC name of N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide (CID 71986830) is N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide.
What is the SMILES notation for N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide?
The canonical SMILES for N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide is CNS(=O)(=O)CCCNC(C)(C)c1nccs1.
What is the InChIKey of N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide?
The InChIKey is MROAWYLIIQPHBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O2S2/c1-10(2,9-12-6-7-16-9)13-5-4-8-17(14,15)11-3/h6-7,11,13H,4-5,8H2,1-3H3.
What are the key properties of N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide?
N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide has a molecular weight of 277.41 g/mol, XLogP of 0.91, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propane-1-sulfonamide is sourced from PubChem (CID 71986830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).