About 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one
3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one (PubChem CID 71986833) has the molecular formula C12H19N3O2S
and a molecular weight of 269.37 g/mol. Its IUPAC name is 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one |
| PubChem CID | 71986833 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(NCCCN1CCOC1=O)c1nccs1 |
| InChI | InChI=1S/C12H19N3O2S/c1-12(2,10-13-5-9-18-10)14-4-3-6-15-7-8-17-11(15)16/h5,9,14H,3-4,6-8H2,1-2H3 |
| InChIKey | VWKCRNCHAWQQGP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one (CID 71986833) is 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one is CC(C)(NCCCN1CCOC1=O)c1nccs1.
What is the InChIKey of 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one?
The InChIKey is VWKCRNCHAWQQGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2S/c1-12(2,10-13-5-9-18-10)14-4-3-6-15-7-8-17-11(15)16/h5,9,14H,3-4,6-8H2,1-2H3.
What are the key properties of 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one?
3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one has a molecular weight of 269.37 g/mol, XLogP of 1.81, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[2-(1,3-thiazol-2-yl)propan-2-ylamino]propyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 71986833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).