About N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide
N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide (PubChem CID 71986837) has the molecular formula C12H21N3OS
and a molecular weight of 255.39 g/mol. Its IUPAC name is N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide |
| PubChem CID | 71986837 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide |
| SMILES | CC(C)(C)NC(=O)CNC(C)(C)c1nccs1 |
| InChI | InChI=1S/C12H21N3OS/c1-11(2,3)15-9(16)8-14-12(4,5)10-13-6-7-17-10/h6-7,14H,8H2,1-5H3,(H,15,16) |
| InChIKey | WBUMASWEZRBFLT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide?
The IUPAC name of N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide (CID 71986837) is N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide.
What is the SMILES notation for N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide?
The canonical SMILES for N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide is CC(C)(C)NC(=O)CNC(C)(C)c1nccs1.
What is the InChIKey of N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide?
The InChIKey is WBUMASWEZRBFLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3OS/c1-11(2,3)15-9(16)8-14-12(4,5)10-13-6-7-17-10/h6-7,14H,8H2,1-5H3,(H,15,16).
What are the key properties of N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide?
N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide has a molecular weight of 255.39 g/mol, XLogP of 1.88, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[2-(1,3-thiazol-2-yl)propan-2-ylamino]acetamide is sourced from PubChem (CID 71986837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).