About 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide
1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide (PubChem CID 71986862) has the molecular formula C13H17N3O2S
and a molecular weight of 279.37 g/mol. Its IUPAC name is 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide.
Molecular Properties
| Compound Name | 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide |
| PubChem CID | 71986862 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide |
| SMILES | N#CCCCCN1CCc2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C13H17N3O2S/c14-7-2-1-3-8-16-9-6-11-4-5-12(10-13(11)16)19(15,17)18/h4-5,10H,1-3,6,8-9H2,(H2,15,17,18) |
| InChIKey | YGCGFZWXEULMRC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide?
The IUPAC name of 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide (CID 71986862) is 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide.
What is the SMILES notation for 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide?
The canonical SMILES for 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide is N#CCCCCN1CCc2ccc(S(N)(=O)=O)cc21.
What is the InChIKey of 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide?
The InChIKey is YGCGFZWXEULMRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2S/c14-7-2-1-3-8-16-9-6-11-4-5-12(10-13(11)16)19(15,17)18/h4-5,10H,1-3,6,8-9H2,(H2,15,17,18).
What are the key properties of 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide?
1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide has a molecular weight of 279.37 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyanobutyl)-2,3-dihydroindole-6-sulfonamide is sourced from PubChem (CID 71986862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).