C15H11F3N2O3 — CID 71987187
methyl 2-pyridin-2-yl-2-[(2,4,6-trifluorobenzoyl)amino]acetate (PubChem CID 71987187) has the molecular formula C15H11F3N2O3 and a molecular weight of 324.26 g/mol. Its IUPAC name is methyl 2-pyridin-2-yl-2-[(2,4,6-trifluorobenzoyl)amino]acetate.
| Compound Name | methyl 2-pyridin-2-yl-2-[(2,4,6-trifluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 71987187 |
| Molecular Formula | C15H11F3N2O3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | methyl 2-pyridin-2-yl-2-[(2,4,6-trifluorobenzoyl)amino]acetate |
| SMILES | COC(=O)C(NC(=O)c1c(F)cc(F)cc1F)c1ccccn1 |
| InChI | InChI=1S/C15H11F3N2O3/c1-23-15(22)13(11-4-2-3-5-19-11)20-14(21)12-9(17)6-8(16)7-10(12)18/h2-7,13H,1H3,(H,20,21) |
| InChIKey | NVORDAKJDQTKOL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |