C19H18N4O2 — CID 71987288
N-(5-cyano-2-pyridinyl)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 71987288) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-(5-cyano-2-pyridinyl)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-(5-cyano-2-pyridinyl)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71987288 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-(5-cyano-2-pyridinyl)-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(CN2C(=O)CCC2C(=O)Nc2ccc(C#N)cn2)cc1 |
| InChI | InChI=1S/C19H18N4O2/c1-13-2-4-14(5-3-13)12-23-16(7-9-18(23)24)19(25)22-17-8-6-15(10-20)11-21-17/h2-6,8,11,16H,7,9,12H2,1H3,(H,21,22,25) |
| InChIKey | LBNNGFYPWXBXEK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |