C11H11NO3S2 — CID 71987403
2-methylsulfanylethyl 2-(furan-3-yl)-1,3-thiazole-4-carboxylate (PubChem CID 71987403) has the molecular formula C11H11NO3S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-methylsulfanylethyl 2-(furan-3-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | 2-methylsulfanylethyl 2-(furan-3-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 71987403 |
| Molecular Formula | C11H11NO3S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 2-methylsulfanylethyl 2-(furan-3-yl)-1,3-thiazole-4-carboxylate |
| SMILES | CSCCOC(=O)c1csc(-c2ccoc2)n1 |
| InChI | InChI=1S/C11H11NO3S2/c1-16-5-4-15-11(13)9-7-17-10(12-9)8-2-3-14-6-8/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | KPLKNAGWLWUIFF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|