About (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate
(4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate (PubChem CID 71987625) has the molecular formula C12H15N3O2S
and a molecular weight of 265.34 g/mol. Its IUPAC name is (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate |
| PubChem CID | 71987625 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate |
| SMILES | CCn1cc(C(=O)OCc2nc(C)c(C)s2)cn1 |
| InChI | InChI=1S/C12H15N3O2S/c1-4-15-6-10(5-13-15)12(16)17-7-11-14-8(2)9(3)18-11/h5-6H,4,7H2,1-3H3 |
| InChIKey | YNQZOAKVUHAVOM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate?
The IUPAC name of (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate (CID 71987625) is (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate.
What is the SMILES notation for (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate?
The canonical SMILES for (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate is CCn1cc(C(=O)OCc2nc(C)c(C)s2)cn1.
What is the InChIKey of (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate?
The InChIKey is YNQZOAKVUHAVOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S/c1-4-15-6-10(5-13-15)12(16)17-7-11-14-8(2)9(3)18-11/h5-6H,4,7H2,1-3H3.
What are the key properties of (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate?
(4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate has a molecular weight of 265.34 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethyl-1,3-thiazol-2-yl)methyl 1-ethylpyrazole-4-carboxylate is sourced from PubChem (CID 71987625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).