About cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate
cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate (PubChem CID 71987742) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| PubChem CID | 71987742 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1noc(C)c1C(=O)OCC1CCC1 |
| InChI | InChI=1S/C11H15NO3/c1-7-10(8(2)15-12-7)11(13)14-6-9-4-3-5-9/h9H,3-6H2,1-2H3 |
| InChIKey | BOVYRKSRSURKEQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate?
The IUPAC name of cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate (CID 71987742) is cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate is Cc1noc(C)c1C(=O)OCC1CCC1.
What is the InChIKey of cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate?
The InChIKey is BOVYRKSRSURKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-7-10(8(2)15-12-7)11(13)14-6-9-4-3-5-9/h9H,3-6H2,1-2H3.
What are the key properties of cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate?
cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate has a molecular weight of 209.24 g/mol, XLogP of 2.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylmethyl 3,5-dimethyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 71987742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).