About 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate
1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 71987994) has the molecular formula C9H13NO3S
and a molecular weight of 215.27 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 71987994 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COCC(C)OC(=O)c1scnc1C |
| InChI | InChI=1S/C9H13NO3S/c1-6(4-12-3)13-9(11)8-7(2)10-5-14-8/h5-6H,4H2,1-3H3 |
| InChIKey | IWHBJEYDAPLFFY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate (CID 71987994) is 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate is COCC(C)OC(=O)c1scnc1C.
What is the InChIKey of 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is IWHBJEYDAPLFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S/c1-6(4-12-3)13-9(11)8-7(2)10-5-14-8/h5-6H,4H2,1-3H3.
What are the key properties of 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate?
1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 215.27 g/mol, XLogP of 1.64, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 71987994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).