About 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate
2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate (PubChem CID 71988167) has the molecular formula C17H16N4O3
and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate.
Molecular Properties
| Compound Name | 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate |
| PubChem CID | 71988167 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate |
| SMILES | Cc1cc(-n2cncn2)ccc1C(=O)OCCn1ccccc1=O |
| InChI | InChI=1S/C17H16N4O3/c1-13-10-14(21-12-18-11-19-21)5-6-15(13)17(23)24-9-8-20-7-3-2-4-16(20)22/h2-7,10-12H,8-9H2,1H3 |
| InChIKey | UHKZMSARHMIZBQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate?
The IUPAC name of 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate (CID 71988167) is 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate.
What is the SMILES notation for 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate?
The canonical SMILES for 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate is Cc1cc(-n2cncn2)ccc1C(=O)OCCn1ccccc1=O.
What is the InChIKey of 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate?
The InChIKey is UHKZMSARHMIZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O3/c1-13-10-14(21-12-18-11-19-21)5-6-15(13)17(23)24-9-8-20-7-3-2-4-16(20)22/h2-7,10-12H,8-9H2,1H3.
What are the key properties of 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate?
2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate has a molecular weight of 324.34 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-1-pyridinyl)ethyl 2-methyl-4-(1,2,4-triazol-1-yl)benzoate is sourced from PubChem (CID 71988167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).