C16H16N2O3S — CID 71988272
thiophen-2-ylmethyl 6-(pyrrolidine-1-carbonyl)pyridine-2-carboxylate (PubChem CID 71988272) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is thiophen-2-ylmethyl 6-(pyrrolidine-1-carbonyl)pyridine-2-carboxylate.
| Compound Name | thiophen-2-ylmethyl 6-(pyrrolidine-1-carbonyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 71988272 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | thiophen-2-ylmethyl 6-(pyrrolidine-1-carbonyl)pyridine-2-carboxylate |
| SMILES | O=C(OCc1cccs1)c1cccc(C(=O)N2CCCC2)n1 |
| InChI | InChI=1S/C16H16N2O3S/c19-15(18-8-1-2-9-18)13-6-3-7-14(17-13)16(20)21-11-12-5-4-10-22-12/h3-7,10H,1-2,8-9,11H2 |
| InChIKey | NTTZCEGJYAGJIE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |