About 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide
3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide (PubChem CID 71988596) has the molecular formula C12H21N5OS
and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide.
Molecular Properties
| Compound Name | 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide |
| PubChem CID | 71988596 |
| Molecular Formula | C12H21N5OS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide |
| SMILES | CCc1nsc(N2CCN(CCC(=O)NC)CC2)n1 |
| InChI | InChI=1S/C12H21N5OS/c1-3-10-14-12(19-15-10)17-8-6-16(7-9-17)5-4-11(18)13-2/h3-9H2,1-2H3,(H,13,18) |
| InChIKey | HZGMREAEUJIBPW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide?
The IUPAC name of 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide (CID 71988596) is 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide.
What is the SMILES notation for 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide?
The canonical SMILES for 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide is CCc1nsc(N2CCN(CCC(=O)NC)CC2)n1.
What is the InChIKey of 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide?
The InChIKey is HZGMREAEUJIBPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5OS/c1-3-10-14-12(19-15-10)17-8-6-16(7-9-17)5-4-11(18)13-2/h3-9H2,1-2H3,(H,13,18).
What are the key properties of 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide?
3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide has a molecular weight of 283.40 g/mol, XLogP of 0.36, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-N-methylpropanamide is sourced from PubChem (CID 71988596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).