About 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide
1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 71988718) has the molecular formula C11H19F3N2O2
and a molecular weight of 268.28 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| PubChem CID | 71988718 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | COCCN1CCCC(C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2O2/c1-18-6-5-16-4-2-3-9(7-16)10(17)15-8-11(12,13)14/h9H,2-8H2,1H3,(H,15,17) |
| InChIKey | ASLVMIDLLVDEDE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide?
The IUPAC name of 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (CID 71988718) is 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
What is the SMILES notation for 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide?
The canonical SMILES for 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide is COCCN1CCCC(C(=O)NCC(F)(F)F)C1.
What is the InChIKey of 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide?
The InChIKey is ASLVMIDLLVDEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O2/c1-18-6-5-16-4-2-3-9(7-16)10(17)15-8-11(12,13)14/h9H,2-8H2,1H3,(H,15,17).
What are the key properties of 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide?
1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide has a molecular weight of 268.28 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide is sourced from PubChem (CID 71988718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).