About 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole
3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole (PubChem CID 71988750) has the molecular formula C15H25N3O3S
and a molecular weight of 327.45 g/mol. Its IUPAC name is 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole |
| PubChem CID | 71988750 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole |
| SMILES | O=S(=O)(Cc1ccon1)N1CCN(CCC2CCCC2)CC1 |
| InChI | InChI=1S/C15H25N3O3S/c19-22(20,13-15-6-12-21-16-15)18-10-8-17(9-11-18)7-5-14-3-1-2-4-14/h6,12,14H,1-5,7-11,13H2 |
| InChIKey | PHFXTIWIDMAUEL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole?
The IUPAC name of 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole (CID 71988750) is 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole.
What is the SMILES notation for 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole?
The canonical SMILES for 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole is O=S(=O)(Cc1ccon1)N1CCN(CCC2CCCC2)CC1.
What is the InChIKey of 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole?
The InChIKey is PHFXTIWIDMAUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O3S/c19-22(20,13-15-6-12-21-16-15)18-10-8-17(9-11-18)7-5-14-3-1-2-4-14/h6,12,14H,1-5,7-11,13H2.
What are the key properties of 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole?
3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole has a molecular weight of 327.45 g/mol, XLogP of 1.70, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2-cyclopentylethyl)piperazin-1-yl]sulfonylmethyl]-1,2-oxazole is sourced from PubChem (CID 71988750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).