About 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine
4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine (PubChem CID 71988974) has the molecular formula C17H24N6O2
and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine.
Molecular Properties
| Compound Name | 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine |
| PubChem CID | 71988974 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine |
| SMILES | Cc1cnc(CN2CCN(c3cc(N4CCOCC4)ncn3)CC2)o1 |
| InChI | InChI=1S/C17H24N6O2/c1-14-11-18-17(25-14)12-21-2-4-22(5-3-21)15-10-16(20-13-19-15)23-6-8-24-9-7-23/h10-11,13H,2-9,12H2,1H3 |
| InChIKey | IYGQEEMAMVUBJC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine?
The IUPAC name of 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine (CID 71988974) is 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine.
What is the SMILES notation for 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine?
The canonical SMILES for 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine is Cc1cnc(CN2CCN(c3cc(N4CCOCC4)ncn3)CC2)o1.
What is the InChIKey of 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine?
The InChIKey is IYGQEEMAMVUBJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N6O2/c1-14-11-18-17(25-14)12-21-2-4-22(5-3-21)15-10-16(20-13-19-15)23-6-8-24-9-7-23/h10-11,13H,2-9,12H2,1H3.
What are the key properties of 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine?
4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine has a molecular weight of 344.42 g/mol, XLogP of 0.93, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-[4-[(5-methyl-1,3-oxazol-2-yl)methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine is sourced from PubChem (CID 71988974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).