C14H18FNO3 — CID 71989568
3-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-4-methylbenzamide (PubChem CID 71989568) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-4-methylbenzamide.
| Compound Name | 3-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 71989568 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC2(O)CCOCC2)cc1F |
| InChI | InChI=1S/C14H18FNO3/c1-10-2-3-11(8-12(10)15)13(17)16-9-14(18)4-6-19-7-5-14/h2-3,8,18H,4-7,9H2,1H3,(H,16,17) |
| InChIKey | APUKAXYFNBTTMX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |