C18H29N3O2 — CID 71989948
N-[3-[cyclobutanecarbonyl(methyl)amino]propyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide (PubChem CID 71989948) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[3-[cyclobutanecarbonyl(methyl)amino]propyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide.
| Compound Name | N-[3-[cyclobutanecarbonyl(methyl)amino]propyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 71989948 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N-[3-[cyclobutanecarbonyl(methyl)amino]propyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
| SMILES | CN(CCCNC(=O)N1CC2CC=CCC2C1)C(=O)C1CCC1 |
| InChI | InChI=1S/C18H29N3O2/c1-20(17(22)14-8-4-9-14)11-5-10-19-18(23)21-12-15-6-2-3-7-16(15)13-21/h2-3,14-16H,4-13H2,1H3,(H,19,23) |
| InChIKey | BAICABUWTCYYSU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|