C18H31N5O2 — CID 71990267
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[1-(1,3,5-trimethylpyrazol-4-yl)propyl]urea (PubChem CID 71990267) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[1-(1,3,5-trimethylpyrazol-4-yl)propyl]urea.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[1-(1,3,5-trimethylpyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 71990267 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[1-(1,3,5-trimethylpyrazol-4-yl)propyl]urea |
| SMILES | CCC(NC(=O)NCC1CN2CCCC2CO1)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C18H31N5O2/c1-5-16(17-12(2)21-22(4)13(17)3)20-18(24)19-9-15-10-23-8-6-7-14(23)11-25-15/h14-16H,5-11H2,1-4H3,(H2,19,20,24) |
| InChIKey | TVUAVICURVDLOK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |