C15H24N4O2S — CID 71990268
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]urea (PubChem CID 71990268) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]urea.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 71990268 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]urea |
| SMILES | CCc1cnc(CNC(=O)NCC2CN3CCCC3CO2)s1 |
| InChI | InChI=1S/C15H24N4O2S/c1-2-13-7-16-14(22-13)8-18-15(20)17-6-12-9-19-5-3-4-11(19)10-21-12/h7,11-12H,2-6,8-10H2,1H3,(H2,17,18,20) |
| InChIKey | QVGMMZXSULKWTQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |