About 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea
1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea (PubChem CID 71990550) has the molecular formula C17H27N3O2S
and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea.
Molecular Properties
| Compound Name | 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea |
| PubChem CID | 71990550 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea |
| SMILES | CC1CCCCC1OCCNC(=O)NC(c1nccs1)C1CC1 |
| InChI | InChI=1S/C17H27N3O2S/c1-12-4-2-3-5-14(12)22-10-8-19-17(21)20-15(13-6-7-13)16-18-9-11-23-16/h9,11-15H,2-8,10H2,1H3,(H2,19,20,21) |
| InChIKey | BYKIGOIHNDZJMP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea?
The IUPAC name of 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea (CID 71990550) is 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea.
What is the SMILES notation for 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea?
The canonical SMILES for 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea is CC1CCCCC1OCCNC(=O)NC(c1nccs1)C1CC1.
What is the InChIKey of 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea?
The InChIKey is BYKIGOIHNDZJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O2S/c1-12-4-2-3-5-14(12)22-10-8-19-17(21)20-15(13-6-7-13)16-18-9-11-23-16/h9,11-15H,2-8,10H2,1H3,(H2,19,20,21).
What are the key properties of 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea?
1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea has a molecular weight of 337.49 g/mol, XLogP of 3.49, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(2-methylcyclohexyl)oxyethyl]urea is sourced from PubChem (CID 71990550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).