About 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea
1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea (PubChem CID 71990553) has the molecular formula C13H23F3N2O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea.
Molecular Properties
| Compound Name | 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea |
| PubChem CID | 71990553 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea |
| SMILES | CC1CCCCC1OCCNC(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O2/c1-10-4-2-3-5-11(10)20-9-8-18-12(19)17-7-6-13(14,15)16/h10-11H,2-9H2,1H3,(H2,17,18,19) |
| InChIKey | GWTNZMYENSYKTI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea?
The IUPAC name of 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea (CID 71990553) is 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea.
What is the SMILES notation for 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea?
The canonical SMILES for 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea is CC1CCCCC1OCCNC(=O)NCCC(F)(F)F.
What is the InChIKey of 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea?
The InChIKey is GWTNZMYENSYKTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F3N2O2/c1-10-4-2-3-5-11(10)20-9-8-18-12(19)17-7-6-13(14,15)16/h10-11H,2-9H2,1H3,(H2,17,18,19).
What are the key properties of 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea?
1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea has a molecular weight of 296.33 g/mol, XLogP of 2.83, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-methylcyclohexyl)oxyethyl]-3-(3,3,3-trifluoropropyl)urea is sourced from PubChem (CID 71990553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).