C19H18N6O — CID 71991071
3-methyl-N-[2-(quinolin-2-ylamino)ethyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 71991071) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-methyl-N-[2-(quinolin-2-ylamino)ethyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | 3-methyl-N-[2-(quinolin-2-ylamino)ethyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 71991071 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-methyl-N-[2-(quinolin-2-ylamino)ethyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | Cc1nnc2ccc(C(=O)NCCNc3ccc4ccccc4n3)cn12 |
| InChI | InChI=1S/C19H18N6O/c1-13-23-24-18-9-7-15(12-25(13)18)19(26)21-11-10-20-17-8-6-14-4-2-3-5-16(14)22-17/h2-9,12H,10-11H2,1H3,(H,20,22)(H,21,26) |
| InChIKey | IWXYRVPIHIQGHY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|