C13H21F3N2O3 — CID 71991481
tert-butyl N-[3-(2,2,2-trifluoroethylcarbamoyl)cyclopentyl]carbamate (PubChem CID 71991481) has the molecular formula C13H21F3N2O3 and a molecular weight of 310.32 g/mol. Its IUPAC name is tert-butyl N-[3-(2,2,2-trifluoroethylcarbamoyl)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,2,2-trifluoroethylcarbamoyl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 71991481 |
| Molecular Formula | C13H21F3N2O3 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | tert-butyl N-[3-(2,2,2-trifluoroethylcarbamoyl)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C13H21F3N2O3/c1-12(2,3)21-11(20)18-9-5-4-8(6-9)10(19)17-7-13(14,15)16/h8-9H,4-7H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | JWKVBQMMNWFJHK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |