About 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea
1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea (PubChem CID 71992031) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea.
Molecular Properties
| Compound Name | 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea |
| PubChem CID | 71992031 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea |
| SMILES | Cn1cccc(NC(=O)NC2CCC(C)(C)CC2)c1=O |
| InChI | InChI=1S/C15H23N3O2/c1-15(2)8-6-11(7-9-15)16-14(20)17-12-5-4-10-18(3)13(12)19/h4-5,10-11H,6-9H2,1-3H3,(H2,16,17,20) |
| InChIKey | RHWCFUGPGVSSTI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea?
The IUPAC name of 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea (CID 71992031) is 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea.
What is the SMILES notation for 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea?
The canonical SMILES for 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea is Cn1cccc(NC(=O)NC2CCC(C)(C)CC2)c1=O.
What is the InChIKey of 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea?
The InChIKey is RHWCFUGPGVSSTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-15(2)8-6-11(7-9-15)16-14(20)17-12-5-4-10-18(3)13(12)19/h4-5,10-11H,6-9H2,1-3H3,(H2,16,17,20).
What are the key properties of 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea?
1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea has a molecular weight of 277.37 g/mol, XLogP of 2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethylcyclohexyl)-3-(1-methyl-2-oxo-3-pyridinyl)urea is sourced from PubChem (CID 71992031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).