C15H16FN3O2S — CID 71992346
2-fluoro-4-[[methyl(2-thiophen-2-ylethyl)carbamoyl]amino]benzamide (PubChem CID 71992346) has the molecular formula C15H16FN3O2S and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-fluoro-4-[[methyl(2-thiophen-2-ylethyl)carbamoyl]amino]benzamide.
| Compound Name | 2-fluoro-4-[[methyl(2-thiophen-2-ylethyl)carbamoyl]amino]benzamide |
|---|---|
| PubChem CID | 71992346 |
| Molecular Formula | C15H16FN3O2S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-fluoro-4-[[methyl(2-thiophen-2-ylethyl)carbamoyl]amino]benzamide |
| SMILES | CN(CCc1cccs1)C(=O)Nc1ccc(C(N)=O)c(F)c1 |
| InChI | InChI=1S/C15H16FN3O2S/c1-19(7-6-11-3-2-8-22-11)15(21)18-10-4-5-12(14(17)20)13(16)9-10/h2-5,8-9H,6-7H2,1H3,(H2,17,20)(H,18,21) |
| InChIKey | NQTQHDISDZXWRV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |