C18H25N5O — CID 71992455
4-benzyl-2-ethyl-N-(1-methylpyrazol-3-yl)piperazine-1-carboxamide (PubChem CID 71992455) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-benzyl-2-ethyl-N-(1-methylpyrazol-3-yl)piperazine-1-carboxamide.
| Compound Name | 4-benzyl-2-ethyl-N-(1-methylpyrazol-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 71992455 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-benzyl-2-ethyl-N-(1-methylpyrazol-3-yl)piperazine-1-carboxamide |
| SMILES | CCC1CN(Cc2ccccc2)CCN1C(=O)Nc1ccn(C)n1 |
| InChI | InChI=1S/C18H25N5O/c1-3-16-14-22(13-15-7-5-4-6-8-15)11-12-23(16)18(24)19-17-9-10-21(2)20-17/h4-10,16H,3,11-14H2,1-2H3,(H,19,20,24) |
| InChIKey | OXJRCYYEWBNWFK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |