C15H22FNO2 — CID 71993281
N-[1-(4-fluorophenyl)-3-methylbutan-2-yl]-3-methoxypropanamide (PubChem CID 71993281) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-3-methylbutan-2-yl]-3-methoxypropanamide.
| Compound Name | N-[1-(4-fluorophenyl)-3-methylbutan-2-yl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 71993281 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[1-(4-fluorophenyl)-3-methylbutan-2-yl]-3-methoxypropanamide |
| SMILES | COCCC(=O)NC(Cc1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C15H22FNO2/c1-11(2)14(17-15(18)8-9-19-3)10-12-4-6-13(16)7-5-12/h4-7,11,14H,8-10H2,1-3H3,(H,17,18) |
| InChIKey | QBLVJMGVAHURRP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |