About N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide
N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide (PubChem CID 71993426) has the molecular formula C15H14F2N4O3
and a molecular weight of 336.30 g/mol. Its IUPAC name is N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide |
| PubChem CID | 71993426 |
| Molecular Formula | C15H14F2N4O3 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NC(c2cc(F)ccc2F)C2CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14F2N4O3/c1-7-14(21(23)24)13(20-19-7)15(22)18-12(8-2-3-8)10-6-9(16)4-5-11(10)17/h4-6,8,12H,2-3H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | USXZMOGQFDCNQP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide?
The IUPAC name of N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide (CID 71993426) is N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide.
What is the SMILES notation for N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide?
The canonical SMILES for N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide is Cc1[nH]nc(C(=O)NC(c2cc(F)ccc2F)C2CC2)c1[N+](=O)[O-].
What is the InChIKey of N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide?
The InChIKey is USXZMOGQFDCNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N4O3/c1-7-14(21(23)24)13(20-19-7)15(22)18-12(8-2-3-8)10-6-9(16)4-5-11(10)17/h4-6,8,12H,2-3H2,1H3,(H,18,22)(H,19,20).
What are the key properties of N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide?
N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide has a molecular weight of 336.30 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyclopropyl-(2,5-difluorophenyl)methyl]-5-methyl-4-nitro-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 71993426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).