C15H20N2O2S — CID 71993594
4-(2-propan-2-ylthiomorpholine-4-carbonyl)benzamide (PubChem CID 71993594) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-(2-propan-2-ylthiomorpholine-4-carbonyl)benzamide.
| Compound Name | 4-(2-propan-2-ylthiomorpholine-4-carbonyl)benzamide |
|---|---|
| PubChem CID | 71993594 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-(2-propan-2-ylthiomorpholine-4-carbonyl)benzamide |
| SMILES | CC(C)C1CN(C(=O)c2ccc(C(N)=O)cc2)CCS1 |
| InChI | InChI=1S/C15H20N2O2S/c1-10(2)13-9-17(7-8-20-13)15(19)12-5-3-11(4-6-12)14(16)18/h3-6,10,13H,7-9H2,1-2H3,(H2,16,18) |
| InChIKey | PUVNTOKMQHKZKT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |